C23H25N3O3 — CID 129347988
(3S,3aS,7aR)-N-(2-methyl-1-oxo-3H-isoindol-4-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide (PubChem CID 129347988) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (3S,3aS,7aR)-N-(2-methyl-1-oxo-3H-isoindol-4-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,7aR)-N-(2-methyl-1-oxo-3H-isoindol-4-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 129347988 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (3S,3aS,7aR)-N-(2-methyl-1-oxo-3H-isoindol-4-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
| SMILES | CN1Cc2c(NC(=O)N3C[C@H](c4ccccc4)[C@@H]4COCC[C@H]43)cccc2C1=O |
| InChI | InChI=1S/C23H25N3O3/c1-25-12-18-16(22(25)27)8-5-9-20(18)24-23(28)26-13-17(15-6-3-2-4-7-15)19-14-29-11-10-21(19)26/h2-9,17,19,21H,10-14H2,1H3,(H,24,28)/t17-,19+,21-/m1/s1 |
| InChIKey | OLFVPSOSNVVIOH-SLYNCCJLSA-N |
| XLogP | 3.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |