About (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone
(3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 129348005) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone.
Molecular Properties
| Compound Name | (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone |
| PubChem CID | 129348005 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | Cn1nnc2c(C(=O)N3CC4(CCCC4)[C@H]3c3ccccc3)ccnc21 |
| InChI | InChI=1S/C20H21N5O/c1-24-18-16(22-23-24)15(9-12-21-18)19(26)25-13-20(10-5-6-11-20)17(25)14-7-3-2-4-8-14/h2-4,7-9,12,17H,5-6,10-11,13H2,1H3/t17-/m1/s1 |
| InChIKey | FFZUWJNDJICYSD-QGZVFWFLSA-N |
| XLogP | 3.12 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone?
The IUPAC name of (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone (CID 129348005) is (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone.
What is the SMILES notation for (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone?
The canonical SMILES for (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone is Cn1nnc2c(C(=O)N3CC4(CCCC4)[C@H]3c3ccccc3)ccnc21.
What is the InChIKey of (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone?
The InChIKey is FFZUWJNDJICYSD-QGZVFWFLSA-N. The full InChI is InChI=1S/C20H21N5O/c1-24-18-16(22-23-24)15(9-12-21-18)19(26)25-13-20(10-5-6-11-20)17(25)14-7-3-2-4-8-14/h2-4,7-9,12,17H,5-6,10-11,13H2,1H3/t17-/m1/s1.
What are the key properties of (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone?
(3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone has a molecular weight of 347.42 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyltriazolo[4,5-b]pyridin-7-yl)-[(3R)-3-phenyl-2-azaspiro[3.4]octan-2-yl]methanone is sourced from PubChem (CID 129348005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).