About (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane
(5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane (PubChem CID 129348579) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane |
| PubChem CID | 129348579 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane |
| SMILES | CC(F)(F)CCN1CC[C@]2(CCOC2)C1 |
| InChI | InChI=1S/C11H19F2NO/c1-10(12,13)2-5-14-6-3-11(8-14)4-7-15-9-11/h2-9H2,1H3/t11-/m0/s1 |
| InChIKey | RTEVWRMXUKSGHE-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane?
The IUPAC name of (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane (CID 129348579) is (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane.
What is the SMILES notation for (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane?
The canonical SMILES for (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane is CC(F)(F)CCN1CC[C@]2(CCOC2)C1.
What is the InChIKey of (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane?
The InChIKey is RTEVWRMXUKSGHE-NSHDSACASA-N. The full InChI is InChI=1S/C11H19F2NO/c1-10(12,13)2-5-14-6-3-11(8-14)4-7-15-9-11/h2-9H2,1H3/t11-/m0/s1.
What are the key properties of (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane?
(5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane has a molecular weight of 219.27 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-(3,3-difluorobutyl)-2-oxa-7-azaspiro[4.4]nonane is sourced from PubChem (CID 129348579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).