About N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide
N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 129348592) has the molecular formula C9H13F2N3O
and a molecular weight of 217.22 g/mol. Its IUPAC name is N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide |
| PubChem CID | 129348592 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cncn1C)C(C)(F)F |
| InChI | InChI=1S/C9H13F2N3O/c1-6(9(2,10)11)13-8(15)7-4-12-5-14(7)3/h4-6H,1-3H3,(H,13,15)/t6-/m0/s1 |
| InChIKey | RIZGLRSEFMRFLU-LURJTMIESA-N |
| XLogP | 1.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide?
The IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide (CID 129348592) is N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide.
What is the SMILES notation for N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide?
The canonical SMILES for N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide is C[C@H](NC(=O)c1cncn1C)C(C)(F)F.
What is the InChIKey of N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide?
The InChIKey is RIZGLRSEFMRFLU-LURJTMIESA-N. The full InChI is InChI=1S/C9H13F2N3O/c1-6(9(2,10)11)13-8(15)7-4-12-5-14(7)3/h4-6H,1-3H3,(H,13,15)/t6-/m0/s1.
What are the key properties of N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide?
N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide has a molecular weight of 217.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-difluorobutan-2-yl]-3-methylimidazole-4-carboxamide is sourced from PubChem (CID 129348592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).