About N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide
N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide (PubChem CID 129348643) has the molecular formula C9H13F2N3O
and a molecular weight of 217.22 g/mol. Its IUPAC name is N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide |
| PubChem CID | 129348643 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)N[C@@H](C)C(C)(F)F)[nH]1 |
| InChI | InChI=1S/C9H13F2N3O/c1-5(9(3,10)11)13-8(15)7-4-12-6(2)14-7/h4-5H,1-3H3,(H,12,14)(H,13,15)/t5-/m0/s1 |
| InChIKey | OQUQPWWXNUSLRC-YFKPBYRVSA-N |
| XLogP | 1.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide?
The IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide (CID 129348643) is N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide.
What is the SMILES notation for N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide?
The canonical SMILES for N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide is Cc1ncc(C(=O)N[C@@H](C)C(C)(F)F)[nH]1.
What is the InChIKey of N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide?
The InChIKey is OQUQPWWXNUSLRC-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H13F2N3O/c1-5(9(3,10)11)13-8(15)7-4-12-6(2)14-7/h4-5H,1-3H3,(H,12,14)(H,13,15)/t5-/m0/s1.
What are the key properties of N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide?
N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide has a molecular weight of 217.22 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-difluorobutan-2-yl]-2-methyl-1H-imidazole-5-carboxamide is sourced from PubChem (CID 129348643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).