About cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone
cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone (PubChem CID 129349148) has the molecular formula C12H17F2NO
and a molecular weight of 229.27 g/mol. Its IUPAC name is cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone |
| PubChem CID | 129349148 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)C2=CCCC2)CCC1(F)F |
| InChI | InChI=1S/C12H17F2NO/c1-9-8-15(7-6-12(9,13)14)11(16)10-4-2-3-5-10/h4,9H,2-3,5-8H2,1H3/t9-/m1/s1 |
| InChIKey | JWHUXRYHUHPNNQ-SECBINFHSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone?
The IUPAC name of cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone (CID 129349148) is cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone.
What is the SMILES notation for cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone?
The canonical SMILES for cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone is C[C@@H]1CN(C(=O)C2=CCCC2)CCC1(F)F.
What is the InChIKey of cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone?
The InChIKey is JWHUXRYHUHPNNQ-SECBINFHSA-N. The full InChI is InChI=1S/C12H17F2NO/c1-9-8-15(7-6-12(9,13)14)11(16)10-4-2-3-5-10/h4,9H,2-3,5-8H2,1H3/t9-/m1/s1.
What are the key properties of cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone?
cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone has a molecular weight of 229.27 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methanone is sourced from PubChem (CID 129349148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).