About 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide
3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide (PubChem CID 129349409) has the molecular formula C11H21FN2O
and a molecular weight of 216.30 g/mol. Its IUPAC name is 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide |
| PubChem CID | 129349409 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1CCC[C@](C)(F)C1 |
| InChI | InChI=1S/C11H21FN2O/c1-11(12)6-4-7-14(9-11)8-5-10(15)13(2)3/h4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZIJFQACCRSWCDW-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide (CID 129349409) is 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide is CN(C)C(=O)CCN1CCC[C@](C)(F)C1.
What is the InChIKey of 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide?
The InChIKey is ZIJFQACCRSWCDW-NSHDSACASA-N. The full InChI is InChI=1S/C11H21FN2O/c1-11(12)6-4-7-14(9-11)8-5-10(15)13(2)3/h4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide?
3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide has a molecular weight of 216.30 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-3-fluoro-3-methylpiperidin-1-yl]-N,N-dimethylpropanamide is sourced from PubChem (CID 129349409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).