C13H25NO3S — CID 129349519
4,4-dimethyl-1-[[(2S)-oxan-2-yl]methylsulfonyl]piperidine (PubChem CID 129349519) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 4,4-dimethyl-1-[[(2S)-oxan-2-yl]methylsulfonyl]piperidine.
| Compound Name | 4,4-dimethyl-1-[[(2S)-oxan-2-yl]methylsulfonyl]piperidine |
|---|---|
| PubChem CID | 129349519 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4,4-dimethyl-1-[[(2S)-oxan-2-yl]methylsulfonyl]piperidine |
| SMILES | CC1(C)CCN(S(=O)(=O)C[C@@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C13H25NO3S/c1-13(2)6-8-14(9-7-13)18(15,16)11-12-5-3-4-10-17-12/h12H,3-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | VZXIXXBXACSPGS-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |