C8H8N4O4S — CID 12934952
4,6-dimethyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxamide (PubChem CID 12934952) has the molecular formula C8H8N4O4S and a molecular weight of 256.24 g/mol. Its IUPAC name is 4,6-dimethyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxamide.
| Compound Name | 4,6-dimethyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 12934952 |
| Molecular Formula | C8H8N4O4S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 4,6-dimethyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxamide |
| SMILES | Cn1c(=O)c2c(sc(C(N)=O)[n+]2[O-])n(C)c1=O |
| InChI | InChI=1S/C8H8N4O4S/c1-10-5(14)3-6(11(2)8(10)15)17-7(4(9)13)12(3)16/h1-2H3,(H2,9,13) |
| InChIKey | XMYJUTJUQHPSHM-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|