About 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone
1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone (PubChem CID 129349677) has the molecular formula C21H29NO3
and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone.
Molecular Properties
| Compound Name | 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone |
| PubChem CID | 129349677 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone |
| SMILES | O=C(CC1CC(c2ccccc2)C1)N1CCC[C@@H]1[C@H]1COCC[C@@H]1O |
| InChI | InChI=1S/C21H29NO3/c23-20-8-10-25-14-18(20)19-7-4-9-22(19)21(24)13-15-11-17(12-15)16-5-2-1-3-6-16/h1-3,5-6,15,17-20,23H,4,7-14H2/t15?,17?,18-,19-,20+/m1/s1 |
| InChIKey | BRAJJTZHZHMVSZ-FLLWYEDFSA-N |
| XLogP | 2.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone?
The IUPAC name of 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone (CID 129349677) is 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone.
What is the SMILES notation for 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone?
The canonical SMILES for 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone is O=C(CC1CC(c2ccccc2)C1)N1CCC[C@@H]1[C@H]1COCC[C@@H]1O.
What is the InChIKey of 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone?
The InChIKey is BRAJJTZHZHMVSZ-FLLWYEDFSA-N. The full InChI is InChI=1S/C21H29NO3/c23-20-8-10-25-14-18(20)19-7-4-9-22(19)21(24)13-15-11-17(12-15)16-5-2-1-3-6-16/h1-3,5-6,15,17-20,23H,4,7-14H2/t15?,17?,18-,19-,20+/m1/s1.
What are the key properties of 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone?
1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone has a molecular weight of 343.47 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone is sourced from PubChem (CID 129349677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).