C19H30N2O3 — CID 12935
1,3-dicyclohexyl-5-propyl-1,3-diazinane-2,4,6-trione (PubChem CID 12935) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-propyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-propyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12935 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1,3-dicyclohexyl-5-propyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H30N2O3/c1-2-9-16-17(22)20(14-10-5-3-6-11-14)19(24)21(18(16)23)15-12-7-4-8-13-15/h14-16H,2-13H2,1H3 |
| InChIKey | NCDGATZHWKMLQV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|