C15H16FN3O — CID 129350956
(3S,5S)-5-(4-fluorophenyl)-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-ol (PubChem CID 129350956) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is (3S,5S)-5-(4-fluorophenyl)-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-(4-fluorophenyl)-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129350956 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3S,5S)-5-(4-fluorophenyl)-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@H]1C[C@@H](c2ccc(F)cc2)N(Cc2cncnc2)C1 |
| InChI | InChI=1S/C15H16FN3O/c16-13-3-1-12(2-4-13)15-5-14(20)9-19(15)8-11-6-17-10-18-7-11/h1-4,6-7,10,14-15,20H,5,8-9H2/t14-,15-/m0/s1 |
| InChIKey | CPSKLWRHXMYISW-GJZGRUSLSA-N |
| XLogP | 1.92 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |