About 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium
2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium (PubChem CID 129352913) has the molecular formula C9HN6+
and a molecular weight of 193.15 g/mol. Its IUPAC name is 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium.
Molecular Properties
| Compound Name | 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium |
| PubChem CID | 129352913 |
| Molecular Formula | C9HN6+ |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium |
| SMILES | N#CC1=C(C#N)C([N+]#N)=C(C#N)C1=C=N |
| InChI | InChI=1S/C9HN6/c10-1-5-6(2-11)8(4-13)9(15-14)7(5)3-12/h10H/q+1 |
| InChIKey | SJMSXNJLWBCYAV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium?
The IUPAC name of 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium (CID 129352913) is 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium.
What is the SMILES notation for 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium?
The canonical SMILES for 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium is N#CC1=C(C#N)C([N+]#N)=C(C#N)C1=C=N.
What is the InChIKey of 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium?
The InChIKey is SJMSXNJLWBCYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9HN6/c10-1-5-6(2-11)8(4-13)9(15-14)7(5)3-12/h10H/q+1.
What are the key properties of 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium?
2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium has a molecular weight of 193.15 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-tricyano-3-(iminomethylidene)cyclopenta-1,4-diene-1-diazonium is sourced from PubChem (CID 129352913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).