C13H15F3N6O — CID 129353221
5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-pyrazole-3-carboxamide (PubChem CID 129353221) has the molecular formula C13H15F3N6O and a molecular weight of 328.30 g/mol. Its IUPAC name is 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129353221 |
| Molecular Formula | C13H15F3N6O |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2nnc3n2C[C@@H](C(F)(F)F)CC3)n[nH]1 |
| InChI | InChI=1S/C13H15F3N6O/c1-7-4-9(19-18-7)12(23)17-5-11-21-20-10-3-2-8(6-22(10)11)13(14,15)16/h4,8H,2-3,5-6H2,1H3,(H,17,23)(H,18,19)/t8-/m0/s1 |
| InChIKey | GOPVXGKOGXUSNN-QMMMGPOBSA-N |
| XLogP | 1.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |