C21H28N4O2 — CID 129353367
6-methoxy-N-[[(8S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide (PubChem CID 129353367) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 6-methoxy-N-[[(8S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide.
| Compound Name | 6-methoxy-N-[[(8S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 129353367 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 6-methoxy-N-[[(8S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
| SMILES | COc1cccc2c1CCN(C(=O)NC[C@@H]1CCCn3cc(C)nc31)CC2 |
| InChI | InChI=1S/C21H28N4O2/c1-15-14-25-10-4-6-17(20(25)23-15)13-22-21(26)24-11-8-16-5-3-7-19(27-2)18(16)9-12-24/h3,5,7,14,17H,4,6,8-13H2,1-2H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | KHAUYKQTYBXSJC-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |