C8H5Br3N4 — CID 129354129
1-(2,4,6-tribromophenyl)-1,2,4-triazol-3-amine (PubChem CID 129354129) has the molecular formula C8H5Br3N4 and a molecular weight of 396.87 g/mol. Its IUPAC name is 1-(2,4,6-tribromophenyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2,4,6-tribromophenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 129354129 |
| Molecular Formula | C8H5Br3N4 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 393.81 |
| IUPAC Name | 1-(2,4,6-tribromophenyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(-c2c(Br)cc(Br)cc2Br)n1 |
| InChI | InChI=1S/C8H5Br3N4/c9-4-1-5(10)7(6(11)2-4)15-3-13-8(12)14-15/h1-3H,(H2,12,14) |
| InChIKey | XIJDCUNLIUXDIX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |