About 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone
1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone (PubChem CID 129354140) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone.
Molecular Properties
| Compound Name | 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone |
| PubChem CID | 129354140 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1C[C@H]2C[C@H]1CO2 |
| InChI | InChI=1S/C14H14N2O2/c17-14(16-7-10-5-9(16)8-18-10)12-6-15-13-4-2-1-3-11(12)13/h1-4,6,9-10,15H,5,7-8H2/t9-,10+/m0/s1 |
| InChIKey | UMVVIEDXJNYDAK-VHSXEESVSA-N |
| XLogP | 1.78 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone?
The IUPAC name of 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone (CID 129354140) is 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone.
What is the SMILES notation for 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone?
The canonical SMILES for 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone is O=C(c1c[nH]c2ccccc12)N1C[C@H]2C[C@H]1CO2.
What is the InChIKey of 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone?
The InChIKey is UMVVIEDXJNYDAK-VHSXEESVSA-N. The full InChI is InChI=1S/C14H14N2O2/c17-14(16-7-10-5-9(16)8-18-10)12-6-15-13-4-2-1-3-11(12)13/h1-4,6,9-10,15H,5,7-8H2/t9-,10+/m0/s1.
What are the key properties of 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone?
1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone has a molecular weight of 242.28 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-yl-[(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone is sourced from PubChem (CID 129354140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).