C17H18FN3O2S — CID 129355253
2-benzylsulfanyl-1-[(3R)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]ethanone (PubChem CID 129355253) has the molecular formula C17H18FN3O2S and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-benzylsulfanyl-1-[(3R)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]ethanone.
| Compound Name | 2-benzylsulfanyl-1-[(3R)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 129355253 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-benzylsulfanyl-1-[(3R)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]ethanone |
| SMILES | O=C(CSCc1ccccc1)N1CC[C@@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C17H18FN3O2S/c18-14-8-19-17(20-9-14)23-15-6-7-21(10-15)16(22)12-24-11-13-4-2-1-3-5-13/h1-5,8-9,15H,6-7,10-12H2/t15-/m1/s1 |
| InChIKey | GCSXXASTMIZXBU-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |