C13H12FN5O2 — CID 129355597
[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 129355597) has the molecular formula C13H12FN5O2 and a molecular weight of 289.27 g/mol. Its IUPAC name is [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 129355597 |
| Molecular Formula | C13H12FN5O2 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CC[C@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C13H12FN5O2/c14-9-5-17-13(18-6-9)21-10-1-4-19(8-10)12(20)11-7-15-2-3-16-11/h2-3,5-7,10H,1,4,8H2/t10-/m0/s1 |
| InChIKey | LRKHUNCCQBVXJQ-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |