About 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine
5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine (PubChem CID 129356522) has the molecular formula C11H13F4N3O3S
and a molecular weight of 343.30 g/mol. Its IUPAC name is 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine |
| PubChem CID | 129356522 |
| Molecular Formula | C11H13F4N3O3S |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine |
| SMILES | O=S(=O)(CCC(F)(F)F)N1CC[C@@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C11H13F4N3O3S/c12-8-5-16-10(17-6-8)21-9-1-3-18(7-9)22(19,20)4-2-11(13,14)15/h5-6,9H,1-4,7H2/t9-/m1/s1 |
| InChIKey | ZMCMWSQYQOCBFP-SECBINFHSA-N |
| XLogP | 1.35 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine?
The IUPAC name of 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine (CID 129356522) is 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine.
What is the SMILES notation for 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine?
The canonical SMILES for 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine is O=S(=O)(CCC(F)(F)F)N1CC[C@@H](Oc2ncc(F)cn2)C1.
What is the InChIKey of 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine?
The InChIKey is ZMCMWSQYQOCBFP-SECBINFHSA-N. The full InChI is InChI=1S/C11H13F4N3O3S/c12-8-5-16-10(17-6-8)21-9-1-3-18(7-9)22(19,20)4-2-11(13,14)15/h5-6,9H,1-4,7H2/t9-/m1/s1.
What are the key properties of 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine?
5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine has a molecular weight of 343.30 g/mol, XLogP of 1.35, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]oxypyrimidine is sourced from PubChem (CID 129356522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).