About 6-methoxychrysene
6-methoxychrysene (PubChem CID 12935769) has the molecular formula C19H14O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-methoxychrysene.
Molecular Properties
| Compound Name | 6-methoxychrysene |
| PubChem CID | 12935769 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-methoxychrysene |
| SMILES | COc1cc2c3ccccc3ccc2c2ccccc12 |
| InChI | InChI=1S/C19H14O/c1-20-19-12-18-14-7-3-2-6-13(14)10-11-16(18)15-8-4-5-9-17(15)19/h2-12H,1H3 |
| InChIKey | ZIWAHVVMLWHLPD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxychrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxychrysene?
The IUPAC name of 6-methoxychrysene (CID 12935769) is 6-methoxychrysene.
What is the SMILES notation for 6-methoxychrysene?
The canonical SMILES for 6-methoxychrysene is COc1cc2c3ccccc3ccc2c2ccccc12.
What is the InChIKey of 6-methoxychrysene?
The InChIKey is ZIWAHVVMLWHLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O/c1-20-19-12-18-14-7-3-2-6-13(14)10-11-16(18)15-8-4-5-9-17(15)19/h2-12H,1H3.
What are the key properties of 6-methoxychrysene?
6-methoxychrysene has a molecular weight of 258.32 g/mol, XLogP of 5.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxychrysene is sourced from PubChem (CID 12935769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).