About 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea
1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea (PubChem CID 129358096) has the molecular formula C11H18F2N4O
and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea |
| PubChem CID | 129358096 |
| Molecular Formula | C11H18F2N4O |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea |
| SMILES | CC[C@@H](C)n1ncc(NC(=O)NCC(F)F)c1C |
| InChI | InChI=1S/C11H18F2N4O/c1-4-7(2)17-8(3)9(5-15-17)16-11(18)14-6-10(12)13/h5,7,10H,4,6H2,1-3H3,(H2,14,16,18)/t7-/m1/s1 |
| InChIKey | AGXQTSTVSMKGQM-SSDOTTSWSA-N |
| XLogP | 2.55 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea?
The IUPAC name of 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea (CID 129358096) is 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea is CC[C@@H](C)n1ncc(NC(=O)NCC(F)F)c1C.
What is the InChIKey of 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea?
The InChIKey is AGXQTSTVSMKGQM-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H18F2N4O/c1-4-7(2)17-8(3)9(5-15-17)16-11(18)14-6-10(12)13/h5,7,10H,4,6H2,1-3H3,(H2,14,16,18)/t7-/m1/s1.
What are the key properties of 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea?
1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea has a molecular weight of 260.29 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2R)-butan-2-yl]-5-methylpyrazol-4-yl]-3-(2,2-difluoroethyl)urea is sourced from PubChem (CID 129358096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).