C17H17F2NO2 — CID 129358679
5-fluoro-N-[(2S)-1-(4-fluorophenyl)-3-hydroxypropan-2-yl]-2-methylbenzamide (PubChem CID 129358679) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is 5-fluoro-N-[(2S)-1-(4-fluorophenyl)-3-hydroxypropan-2-yl]-2-methylbenzamide.
| Compound Name | 5-fluoro-N-[(2S)-1-(4-fluorophenyl)-3-hydroxypropan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 129358679 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-fluoro-N-[(2S)-1-(4-fluorophenyl)-3-hydroxypropan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)N[C@H](CO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17F2NO2/c1-11-2-5-14(19)9-16(11)17(22)20-15(10-21)8-12-3-6-13(18)7-4-12/h2-7,9,15,21H,8,10H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | REICYDHFDAAQDR-HNNXBMFYSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |