C10H20OSi — CID 12935881
(1E,4E)-4-methyl-1-trimethylsilylhexa-1,4-dien-3-ol (PubChem CID 12935881) has the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. Its IUPAC name is (1E,4E)-4-methyl-1-trimethylsilylhexa-1,4-dien-3-ol.
| Compound Name | (1E,4E)-4-methyl-1-trimethylsilylhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 12935881 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (1E,4E)-4-methyl-1-trimethylsilylhexa-1,4-dien-3-ol |
| SMILES | C/C=C(\C)C(O)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C10H20OSi/c1-6-9(2)10(11)7-8-12(3,4)5/h6-8,10-11H,1-5H3/b8-7+,9-6+ |
| InChIKey | VUJCZPPTXWVGOS-KHHFIZIMSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|