C10H14O3 — CID 12935901
4-methoxy-4-propan-2-yloxycyclohexa-2,5-dien-1-one (PubChem CID 12935901) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-methoxy-4-propan-2-yloxycyclohexa-2,5-dien-1-one.
| Compound Name | 4-methoxy-4-propan-2-yloxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 12935901 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-methoxy-4-propan-2-yloxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC(C)C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H14O3/c1-8(2)13-10(12-3)6-4-9(11)5-7-10/h4-8H,1-3H3 |
| InChIKey | XXWYNKUMWPXSNT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|