About (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane
(3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane (PubChem CID 129359674) has the molecular formula C8H14BrF3
and a molecular weight of 247.10 g/mol. Its IUPAC name is (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane.
Molecular Properties
| Compound Name | (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane |
| PubChem CID | 129359674 |
| Molecular Formula | C8H14BrF3 |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane |
| SMILES | CC(C)C[C@H](CBr)CC(F)(F)F |
| InChI | InChI=1S/C8H14BrF3/c1-6(2)3-7(5-9)4-8(10,11)12/h6-7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | QIPQAYNVRBXREH-ZETCQYMHSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane?
The IUPAC name of (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane (CID 129359674) is (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane.
What is the SMILES notation for (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane?
The canonical SMILES for (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane is CC(C)C[C@H](CBr)CC(F)(F)F.
What is the InChIKey of (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane?
The InChIKey is QIPQAYNVRBXREH-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H14BrF3/c1-6(2)3-7(5-9)4-8(10,11)12/h6-7H,3-5H2,1-2H3/t7-/m0/s1.
What are the key properties of (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane?
(3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane has a molecular weight of 247.10 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(bromomethyl)-1,1,1-trifluoro-5-methylhexane is sourced from PubChem (CID 129359674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).