C13H15ClO — CID 12935994
(Z)-3-chloro-2-methyl-3-(2,4,5-trimethylphenyl)prop-2-enal (PubChem CID 12935994) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is (Z)-3-chloro-2-methyl-3-(2,4,5-trimethylphenyl)prop-2-enal.
| Compound Name | (Z)-3-chloro-2-methyl-3-(2,4,5-trimethylphenyl)prop-2-enal |
|---|---|
| PubChem CID | 12935994 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (Z)-3-chloro-2-methyl-3-(2,4,5-trimethylphenyl)prop-2-enal |
| SMILES | C/C(C=O)=C(/Cl)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C13H15ClO/c1-8-5-10(3)12(6-9(8)2)13(14)11(4)7-15/h5-7H,1-4H3/b13-11- |
| InChIKey | ISTOBSIGEYAQMP-QBFSEMIESA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|