C20H18ClNO2 — CID 129361874
4-[(1R,2S)-2-(3-chlorophenyl)-2-hydroxy-1-pyridin-2-ylpropyl]phenol (PubChem CID 129361874) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-[(1R,2S)-2-(3-chlorophenyl)-2-hydroxy-1-pyridin-2-ylpropyl]phenol.
| Compound Name | 4-[(1R,2S)-2-(3-chlorophenyl)-2-hydroxy-1-pyridin-2-ylpropyl]phenol |
|---|---|
| PubChem CID | 129361874 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[(1R,2S)-2-(3-chlorophenyl)-2-hydroxy-1-pyridin-2-ylpropyl]phenol |
| SMILES | C[C@@](O)(c1cccc(Cl)c1)[C@H](c1ccc(O)cc1)c1ccccn1 |
| InChI | InChI=1S/C20H18ClNO2/c1-20(24,15-5-4-6-16(21)13-15)19(18-7-2-3-12-22-18)14-8-10-17(23)11-9-14/h2-13,19,23-24H,1H3/t19-,20-/m1/s1 |
| InChIKey | AFGHHQYPGGUUDY-WOJBJXKFSA-N |
| XLogP | 4.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |