C19H20F2N2 — CID 129362234
(4R)-4-(3,5-difluorophenyl)-2,7-dimethyl-3,4,8,9-tetrahydro-1H-pyrrolo[2,3-h]isoquinoline (PubChem CID 129362234) has the molecular formula C19H20F2N2 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4R)-4-(3,5-difluorophenyl)-2,7-dimethyl-3,4,8,9-tetrahydro-1H-pyrrolo[2,3-h]isoquinoline.
| Compound Name | (4R)-4-(3,5-difluorophenyl)-2,7-dimethyl-3,4,8,9-tetrahydro-1H-pyrrolo[2,3-h]isoquinoline |
|---|---|
| PubChem CID | 129362234 |
| Molecular Formula | C19H20F2N2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (4R)-4-(3,5-difluorophenyl)-2,7-dimethyl-3,4,8,9-tetrahydro-1H-pyrrolo[2,3-h]isoquinoline |
| SMILES | CN1Cc2c(ccc3c2CCN3C)[C@@H](c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C19H20F2N2/c1-22-10-17(12-7-13(20)9-14(21)8-12)15-3-4-19-16(18(15)11-22)5-6-23(19)2/h3-4,7-9,17H,5-6,10-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | WMKWOTNPFLAFPU-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |