C11H10N2O3 — CID 129362406
(1S,3R)-1-hydroxyspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 129362406) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is (1S,3R)-1-hydroxyspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (1S,3R)-1-hydroxyspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 129362406 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (1S,3R)-1-hydroxyspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)[C@]2(C[C@H](O)c3ccccc32)N1 |
| InChI | InChI=1S/C11H10N2O3/c14-8-5-11(9(15)12-10(16)13-11)7-4-2-1-3-6(7)8/h1-4,8,14H,5H2,(H2,12,13,15,16)/t8-,11+/m0/s1 |
| InChIKey | ZIWCGDTXUPRVJG-GZMMTYOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|