About 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine
2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine (PubChem CID 129362478) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine.
Molecular Properties
| Compound Name | 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| PubChem CID | 129362478 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| SMILES | CC[C@@H](C)N1CCc2ccc(N)c(N)c2C1 |
| InChI | InChI=1S/C13H21N3/c1-3-9(2)16-7-6-10-4-5-12(14)13(15)11(10)8-16/h4-5,9H,3,6-8,14-15H2,1-2H3/t9-/m1/s1 |
| InChIKey | KKVQFAPTILLXEU-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The IUPAC name of 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine (CID 129362478) is 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine.
What is the SMILES notation for 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The canonical SMILES for 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine is CC[C@@H](C)N1CCc2ccc(N)c(N)c2C1.
What is the InChIKey of 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The InChIKey is KKVQFAPTILLXEU-SECBINFHSA-N. The full InChI is InChI=1S/C13H21N3/c1-3-9(2)16-7-6-10-4-5-12(14)13(15)11(10)8-16/h4-5,9H,3,6-8,14-15H2,1-2H3/t9-/m1/s1.
What are the key properties of 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine?
2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine has a molecular weight of 219.33 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-butan-2-yl]-3,4-dihydro-1H-isoquinoline-7,8-diamine is sourced from PubChem (CID 129362478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).