About (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol
(2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol (PubChem CID 129362641) has the molecular formula C15H20OS
and a molecular weight of 248.39 g/mol. Its IUPAC name is (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol.
Molecular Properties
| Compound Name | (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol |
| PubChem CID | 129362641 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol |
| SMILES | C=C[C@@](C)(O)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C15H20OS/c1-5-15(4,16)11-6-7-13-12(10-11)14(2,3)8-9-17-13/h5-7,10,16H,1,8-9H2,2-4H3/t15-/m1/s1 |
| InChIKey | ZTVLPPLXSCVPEK-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol?
The IUPAC name of (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol (CID 129362641) is (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol.
What is the SMILES notation for (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol?
The canonical SMILES for (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol is C=C[C@@](C)(O)c1ccc2c(c1)C(C)(C)CCS2.
What is the InChIKey of (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol?
The InChIKey is ZTVLPPLXSCVPEK-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H20OS/c1-5-15(4,16)11-6-7-13-12(10-11)14(2,3)8-9-17-13/h5-7,10,16H,1,8-9H2,2-4H3/t15-/m1/s1.
What are the key properties of (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol?
(2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol has a molecular weight of 248.39 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)but-3-en-2-ol is sourced from PubChem (CID 129362641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).