About (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole
(4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 129362660) has the molecular formula C15H12Cl2N2
and a molecular weight of 291.18 g/mol. Its IUPAC name is (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole |
| PubChem CID | 129362660 |
| Molecular Formula | C15H12Cl2N2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Clc1ccc(C2=NNC[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H12Cl2N2/c16-12-5-1-10(2-6-12)14-9-18-19-15(14)11-3-7-13(17)8-4-11/h1-8,14,18H,9H2/t14-/m0/s1 |
| InChIKey | PFGKWFCAKAOYOL-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole?
The IUPAC name of (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole (CID 129362660) is (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole?
The canonical SMILES for (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole is Clc1ccc(C2=NNC[C@H]2c2ccc(Cl)cc2)cc1.
What is the InChIKey of (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole?
The InChIKey is PFGKWFCAKAOYOL-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H12Cl2N2/c16-12-5-1-10(2-6-12)14-9-18-19-15(14)11-3-7-13(17)8-4-11/h1-8,14,18H,9H2/t14-/m0/s1.
What are the key properties of (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole?
(4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole has a molecular weight of 291.18 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,4-bis(4-chlorophenyl)-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 129362660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).