About N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide
N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide (PubChem CID 129363160) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide.
Molecular Properties
| Compound Name | N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide |
| PubChem CID | 129363160 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide |
| SMILES | CCC/C(=N\[C@H]1CCc2ccccc21)NC#N |
| InChI | InChI=1S/C14H17N3/c1-2-5-14(16-10-15)17-13-9-8-11-6-3-4-7-12(11)13/h3-4,6-7,13H,2,5,8-9H2,1H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | XXYMYKWCGJLLTF-ZDUSSCGKSA-N |
| XLogP | 2.94 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide?
The IUPAC name of N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide (CID 129363160) is N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide.
What is the SMILES notation for N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide?
The canonical SMILES for N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide is CCC/C(=N\[C@H]1CCc2ccccc21)NC#N.
What is the InChIKey of N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide?
The InChIKey is XXYMYKWCGJLLTF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H17N3/c1-2-5-14(16-10-15)17-13-9-8-11-6-3-4-7-12(11)13/h3-4,6-7,13H,2,5,8-9H2,1H3,(H,16,17)/t13-/m0/s1.
What are the key properties of N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide?
N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide has a molecular weight of 227.31 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-[(1S)-2,3-dihydro-1H-inden-1-yl]butanimidamide is sourced from PubChem (CID 129363160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).