C16H21ClO2 — CID 129363438
3-chloro-2a,3,4,5,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydroaceanthrylene-1,2-dione (PubChem CID 129363438) has the molecular formula C16H21ClO2 and a molecular weight of 280.80 g/mol. Its IUPAC name is 3-chloro-2a,3,4,5,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydroaceanthrylene-1,2-dione.
| Compound Name | 3-chloro-2a,3,4,5,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydroaceanthrylene-1,2-dione |
|---|---|
| PubChem CID | 129363438 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-chloro-2a,3,4,5,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydroaceanthrylene-1,2-dione |
| SMILES | O=C1C(=O)C2C3CCCCC3CC3CCC(Cl)C1C32 |
| InChI | InChI=1S/C16H21ClO2/c17-11-6-5-9-7-8-3-1-2-4-10(8)13-12(9)14(11)16(19)15(13)18/h8-14H,1-7H2 |
| InChIKey | KYESYWHTAOIPPJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|