About (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine
(9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine (PubChem CID 129363571) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine.
Molecular Properties
| Compound Name | (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine |
| PubChem CID | 129363571 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine |
| SMILES | COc1ccc2c(c1OC)-c1ccccc1[C@H](N)C2 |
| InChI | InChI=1S/C16H17NO2/c1-18-14-8-7-10-9-13(17)11-5-3-4-6-12(11)15(10)16(14)19-2/h3-8,13H,9,17H2,1-2H3/t13-/m1/s1 |
| InChIKey | DLCVQINXHXGVKK-CYBMUJFWSA-N |
| XLogP | 2.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine?
The IUPAC name of (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine (CID 129363571) is (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine.
What is the SMILES notation for (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine?
The canonical SMILES for (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine is COc1ccc2c(c1OC)-c1ccccc1[C@H](N)C2.
What is the InChIKey of (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine?
The InChIKey is DLCVQINXHXGVKK-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H17NO2/c1-18-14-8-7-10-9-13(17)11-5-3-4-6-12(11)15(10)16(14)19-2/h3-8,13H,9,17H2,1-2H3/t13-/m1/s1.
What are the key properties of (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine?
(9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine has a molecular weight of 255.32 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-3,4-dimethoxy-9,10-dihydrophenanthren-9-amine is sourced from PubChem (CID 129363571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).