C12H12O3 — CID 129363713
(5R)-5-hydroxy-5-(2-phenylethyl)furan-2-one (PubChem CID 129363713) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (5R)-5-hydroxy-5-(2-phenylethyl)furan-2-one.
| Compound Name | (5R)-5-hydroxy-5-(2-phenylethyl)furan-2-one |
|---|---|
| PubChem CID | 129363713 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (5R)-5-hydroxy-5-(2-phenylethyl)furan-2-one |
| SMILES | O=C1C=C[C@@](O)(CCc2ccccc2)O1 |
| InChI | InChI=1S/C12H12O3/c13-11-7-9-12(14,15-11)8-6-10-4-2-1-3-5-10/h1-5,7,9,14H,6,8H2/t12-/m1/s1 |
| InChIKey | PARVGYYUPWYHCI-GFCCVEGCSA-N |
| XLogP | 1.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |