C14H13NOS — CID 129364052
(7R)-4-methyl-7-thiophen-2-yl-7,8-dihydro-6H-quinolin-5-one (PubChem CID 129364052) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is (7R)-4-methyl-7-thiophen-2-yl-7,8-dihydro-6H-quinolin-5-one.
| Compound Name | (7R)-4-methyl-7-thiophen-2-yl-7,8-dihydro-6H-quinolin-5-one |
|---|---|
| PubChem CID | 129364052 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (7R)-4-methyl-7-thiophen-2-yl-7,8-dihydro-6H-quinolin-5-one |
| SMILES | Cc1ccnc2c1C(=O)C[C@H](c1cccs1)C2 |
| InChI | InChI=1S/C14H13NOS/c1-9-4-5-15-11-7-10(8-12(16)14(9)11)13-3-2-6-17-13/h2-6,10H,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | CCWMOXAMEDFWMM-SNVBAGLBSA-N |
| XLogP | 3.36 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |