C12H12N2OS2 — CID 129364988
(5R)-5-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 129364988) has the molecular formula C12H12N2OS2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (5R)-5-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]-6,7-dihydro-5H-1-benzothiophen-4-one.
| Compound Name | (5R)-5-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]-6,7-dihydro-5H-1-benzothiophen-4-one |
|---|---|
| PubChem CID | 129364988 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (5R)-5-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | O=C1c2ccsc2CC[C@@H]1Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H12N2OS2/c15-11-7(5-8-6-13-12(16)14-8)1-2-10-9(11)3-4-17-10/h3-4,6-7H,1-2,5H2,(H2,13,14,16)/t7-/m1/s1 |
| InChIKey | RVXNKKVSQPIDHP-SSDOTTSWSA-N |
| XLogP | 3.12 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|