C16H32N2O2 — CID 129365879
(2R)-1-(tert-butylamino)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]oxypropan-2-ol (PubChem CID 129365879) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is (2R)-1-(tert-butylamino)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]oxypropan-2-ol.
| Compound Name | (2R)-1-(tert-butylamino)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 129365879 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | (2R)-1-(tert-butylamino)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]oxypropan-2-ol |
| SMILES | C[C@@H]1C/C(=N/OC[C@H](O)CNC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2O2/c1-12-7-13(9-16(5,6)8-12)18-20-11-14(19)10-17-15(2,3)4/h12,14,17,19H,7-11H2,1-6H3/b18-13-/t12-,14-/m1/s1 |
| InChIKey | YQZGYLVYTGIJAX-WNJIMBKESA-N |
| XLogP | 2.95 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|