About (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline
(2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline (PubChem CID 129365938) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline.
Molecular Properties
| Compound Name | (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline |
| PubChem CID | 129365938 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline |
| SMILES | c1ccc([C@@H]2NCc3ccccc3N2)cc1 |
| InChI | InChI=1S/C14H14N2/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-9,14-16H,10H2/t14-/m1/s1 |
| InChIKey | ZPOOXQHMBHARAH-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline?
The IUPAC name of (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline (CID 129365938) is (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline.
What is the SMILES notation for (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline?
The canonical SMILES for (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline is c1ccc([C@@H]2NCc3ccccc3N2)cc1.
What is the InChIKey of (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline?
The InChIKey is ZPOOXQHMBHARAH-CQSZACIVSA-N. The full InChI is InChI=1S/C14H14N2/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-9,14-16H,10H2/t14-/m1/s1.
What are the key properties of (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline?
(2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline has a molecular weight of 210.28 g/mol, XLogP of 2.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenyl-1,2,3,4-tetrahydroquinazoline is sourced from PubChem (CID 129365938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).