C11H14F3N3O — CID 129367196
(5-methyl-1H-pyrazol-3-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 129367196) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is (5-methyl-1H-pyrazol-3-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (5-methyl-1H-pyrazol-3-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129367196 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (5-methyl-1H-pyrazol-3-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@@H](C(F)(F)F)C2)n[nH]1 |
| InChI | InChI=1S/C11H14F3N3O/c1-7-5-9(16-15-7)10(18)17-4-2-3-8(6-17)11(12,13)14/h5,8H,2-4,6H2,1H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | JGKSGUVBOFSGQG-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |