About (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine
(2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine (PubChem CID 129367470) has the molecular formula C9H9F2NS
and a molecular weight of 201.24 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine |
| PubChem CID | 129367470 |
| Molecular Formula | C9H9F2NS |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine |
| SMILES | Fc1ccc(F)c([C@@H]2NCCS2)c1 |
| InChI | InChI=1S/C9H9F2NS/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-2,5,9,12H,3-4H2/t9-/m1/s1 |
| InChIKey | SCKGWYLNRADUMP-SECBINFHSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine?
The IUPAC name of (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine (CID 129367470) is (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine.
What is the SMILES notation for (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine?
The canonical SMILES for (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine is Fc1ccc(F)c([C@@H]2NCCS2)c1.
What is the InChIKey of (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine?
The InChIKey is SCKGWYLNRADUMP-SECBINFHSA-N. The full InChI is InChI=1S/C9H9F2NS/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-2,5,9,12H,3-4H2/t9-/m1/s1.
What are the key properties of (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine?
(2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine has a molecular weight of 201.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,5-difluorophenyl)-1,3-thiazolidine is sourced from PubChem (CID 129367470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).