C10H14ClN3S — CID 129367917
6-chloro-N,2-dimethyl-N-[(3S)-thiolan-3-yl]pyrimidin-4-amine (PubChem CID 129367917) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 6-chloro-N,2-dimethyl-N-[(3S)-thiolan-3-yl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N,2-dimethyl-N-[(3S)-thiolan-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129367917 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-chloro-N,2-dimethyl-N-[(3S)-thiolan-3-yl]pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)cc(N(C)[C@H]2CCSC2)n1 |
| InChI | InChI=1S/C10H14ClN3S/c1-7-12-9(11)5-10(13-7)14(2)8-3-4-15-6-8/h5,8H,3-4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | VMCNBPZGMIQWCV-QMMMGPOBSA-N |
| XLogP | 2.38 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |