C9H14N2O5S — CID 129368980
N-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-isothiocyanatooxan-3-yl]acetamide (PubChem CID 129368980) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-isothiocyanatooxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-isothiocyanatooxan-3-yl]acetamide |
|---|---|
| PubChem CID | 129368980 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-isothiocyanatooxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](O)[C@H](O)[C@H](CO)O[C@@H]1N=C=S |
| InChI | InChI=1S/C9H14N2O5S/c1-4(13)11-6-8(15)7(14)5(2-12)16-9(6)10-3-17/h5-9,12,14-15H,2H2,1H3,(H,11,13)/t5-,6-,7+,8+,9-/m0/s1 |
| InChIKey | WOOPLNBBEKGAOH-ABXGFROZSA-N |
| XLogP | -1.97 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|