About (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one
(2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one (PubChem CID 129369145) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one.
Molecular Properties
| Compound Name | (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one |
| PubChem CID | 129369145 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one |
| SMILES | C[C@@H]1Oc2ccccc2CN(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C17H15NO4/c1-11-17(19)18(9-12-4-2-3-5-14(12)22-11)13-6-7-15-16(8-13)21-10-20-15/h2-8,11H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | VCZUFOPPXRUXOQ-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one?
The IUPAC name of (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one (CID 129369145) is (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one.
What is the SMILES notation for (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one?
The canonical SMILES for (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one is C[C@@H]1Oc2ccccc2CN(c2ccc3c(c2)OCO3)C1=O.
What is the InChIKey of (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one?
The InChIKey is VCZUFOPPXRUXOQ-NSHDSACASA-N. The full InChI is InChI=1S/C17H15NO4/c1-11-17(19)18(9-12-4-2-3-5-14(12)22-11)13-6-7-15-16(8-13)21-10-20-15/h2-8,11H,9-10H2,1H3/t11-/m0/s1.
What are the key properties of (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one?
(2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one has a molecular weight of 297.31 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5H-1,4-benzoxazepin-3-one is sourced from PubChem (CID 129369145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).