About (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide
(3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide (PubChem CID 129369661) has the molecular formula C12H22N2O3S
and a molecular weight of 274.39 g/mol. Its IUPAC name is (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide |
| PubChem CID | 129369661 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide |
| SMILES | C[C@@]1(C(=O)N[C@@H]2CCCS(=O)(=O)C2)CCCNC1 |
| InChI | InChI=1S/C12H22N2O3S/c1-12(5-3-6-13-9-12)11(15)14-10-4-2-7-18(16,17)8-10/h10,13H,2-9H2,1H3,(H,14,15)/t10-,12-/m1/s1 |
| InChIKey | FMWPRUMJPSBQBZ-ZYHUDNBSSA-N |
| XLogP | 0.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide?
The IUPAC name of (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide (CID 129369661) is (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide.
What is the SMILES notation for (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide?
The canonical SMILES for (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide is C[C@@]1(C(=O)N[C@@H]2CCCS(=O)(=O)C2)CCCNC1.
What is the InChIKey of (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide?
The InChIKey is FMWPRUMJPSBQBZ-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H22N2O3S/c1-12(5-3-6-13-9-12)11(15)14-10-4-2-7-18(16,17)8-10/h10,13H,2-9H2,1H3,(H,14,15)/t10-,12-/m1/s1.
What are the key properties of (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide?
(3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide has a molecular weight of 274.39 g/mol, XLogP of 0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(3R)-1,1-dioxothian-3-yl]-3-methylpiperidine-3-carboxamide is sourced from PubChem (CID 129369661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).