About 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea
1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea (PubChem CID 129370932) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea |
| PubChem CID | 129370932 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea |
| SMILES | Cc1cc([C@H](C)NC(=O)NC2CCOCC2)c(C)s1 |
| InChI | InChI=1S/C14H22N2O2S/c1-9-8-13(11(3)19-9)10(2)15-14(17)16-12-4-6-18-7-5-12/h8,10,12H,4-7H2,1-3H3,(H2,15,16,17)/t10-/m0/s1 |
| InChIKey | HSYDTODCXMHXPQ-JTQLQIEISA-N |
| XLogP | 2.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea?
The IUPAC name of 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea (CID 129370932) is 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea.
What is the SMILES notation for 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea?
The canonical SMILES for 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea is Cc1cc([C@H](C)NC(=O)NC2CCOCC2)c(C)s1.
What is the InChIKey of 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea?
The InChIKey is HSYDTODCXMHXPQ-JTQLQIEISA-N. The full InChI is InChI=1S/C14H22N2O2S/c1-9-8-13(11(3)19-9)10(2)15-14(17)16-12-4-6-18-7-5-12/h8,10,12H,4-7H2,1-3H3,(H2,15,16,17)/t10-/m0/s1.
What are the key properties of 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea?
1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea has a molecular weight of 282.41 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxan-4-yl)urea is sourced from PubChem (CID 129370932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).