C15H21NO2 — CID 129371230
tert-butyl N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 129371230) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 129371230 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | tert-butyl N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO2/c1-15(2,3)18-14(17)16-13-9-8-11-6-4-5-7-12(11)10-13/h4-7,13H,8-10H2,1-3H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | IYNXYMFBCOZXLY-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |