About 5-ethyl-2,5-dimethoxy-2H-furan
5-ethyl-2,5-dimethoxy-2H-furan (PubChem CID 12937295) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-ethyl-2,5-dimethoxy-2H-furan.
Molecular Properties
| Compound Name | 5-ethyl-2,5-dimethoxy-2H-furan |
| PubChem CID | 12937295 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 5-ethyl-2,5-dimethoxy-2H-furan |
| SMILES | CCC1(OC)C=CC(OC)O1 |
| InChI | InChI=1S/C8H14O3/c1-4-8(10-3)6-5-7(9-2)11-8/h5-7H,4H2,1-3H3 |
| InChIKey | IAFCIPIBKATVRC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,5-dimethoxy-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,5-dimethoxy-2H-furan?
The IUPAC name of 5-ethyl-2,5-dimethoxy-2H-furan (CID 12937295) is 5-ethyl-2,5-dimethoxy-2H-furan.
What is the SMILES notation for 5-ethyl-2,5-dimethoxy-2H-furan?
The canonical SMILES for 5-ethyl-2,5-dimethoxy-2H-furan is CCC1(OC)C=CC(OC)O1.
What is the InChIKey of 5-ethyl-2,5-dimethoxy-2H-furan?
The InChIKey is IAFCIPIBKATVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-8(10-3)6-5-7(9-2)11-8/h5-7H,4H2,1-3H3.
What are the key properties of 5-ethyl-2,5-dimethoxy-2H-furan?
5-ethyl-2,5-dimethoxy-2H-furan has a molecular weight of 158.20 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,5-dimethoxy-2H-furan is sourced from PubChem (CID 12937295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).